A2313512
(+/-)-Camphene , Analysis standard , 79-92-5
Synonym(s):
(+)-Camphene;(1R)-2,2-Dimethyl-3-methylenebicyclo[2.2.1]heptane;DL -Camphene;2,2-Dimethyl-3-methylenebicyclo[2.2.1]heptane, 3,3-Dimethyl-2-methylenenorcamphane;2,2-Dimethyl-3-methylidenebicyclo[2.2.1]heptane
CAS NO.:79-92-5
Empirical Formula: C10H16
Molecular Weight: 136.23
MDL number: MFCD00066603
EINECS: 201-234-8
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-52 °C (lit.) |
| Boiling point: | 159-160 °C (lit.) |
| Density | 0.85 g/mL at 25 °C (lit.) |
| vapor pressure | 3.99 hPa (20 °C) |
| refractive index | 1.4551 |
| FEMA | 2229 | CAMPHENE |
| Flash point: | 94 °F |
| storage temp. | 2-8°C |
| solubility | 0.0042g/l |
| form | Crystalline Low Melting Solid |
| color | White |
| Specific Gravity | 0.85 |
| PH | 5.5 (H2O, 22℃)(saturated aqueous solution) |
| Odor | at 10.00 % in dipropylene glycol. woody herbal fir needle camphor terpenic |
| Odor Type | woody |
| biological source | synthetic |
| Odor Threshold | 0.88ppm |
| Water Solubility | practically insoluble |
| Merck | 14,1730 |
| JECFA Number | 1323 |
| Dielectric constant | 2.7(20℃) |
| Cosmetics Ingredients Functions | FRAGRANCE PERFUMING |
| InChI | 1S/C10H16/c1-7-8-4-5-9(6-8)10(7,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9+/m0/s1 |
| InChIKey | CRPUJAZIXJMDBK-DTWKUNHWSA-N |
| SMILES | [H][C@]12CC[C@]([H])(C1)C(C)(C)C2=C |
| LogP | 4.22 at 20℃ |
| CAS DataBase Reference | 79-92-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Camphene(79-92-5) |
| EPA Substance Registry System | Camphene (79-92-5) |
Description and Uses
Camphene is a colorless to white crystallinesolid with camphor-like odor. It may be shipped as a liquid.Freezing/Melting point=50℃. Molecular weight=136.24;Boiling point=159℃; Melting point=37℃; Flashpoint=42℃ (oc); 33℃ (cc). Hazard Identification (basedon NFPA-704 M Rating System): Health 2, Flammability 3,Reactivity 0. Insoluble in water.
Camphene is used in the preparation of fragrances and as a food additive for flavoring.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H228-H319-H410 |
| Precautionary statements | P210-P240-P241-P264-P273-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,N |
| Risk Statements | 11-10-50/53-36 |
| Safety Statements | 16-33-61-60-26 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 2 |
| RTECS | EX1055000 |
| Autoignition Temperature | 265 °C |
| TSCA | TSCA listed |
| HS Code | 2902 19 00 |
| HazardClass | 4.1 |
| PackingGroup | III |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Flam. Sol. 1 |
| Hazardous Substances Data | 79-92-5(Hazardous Substances Data) |







