A2316112
Chelerythrine chloride , Analysis of standards,> 98% , 34316-15-9
Synonym(s):
1,2-Dimethoxy-N-methyl(1,3)benzodioxolo(5,6-c)phenanthridinium chloride;Toddaline chloride
CAS NO.:34316-15-9
Empirical Formula: C21H18NO4+
Molecular Weight: 348.372
MDL number: MFCD00060717
EINECS: 251-930-0
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-205°C |
| Boiling point: | 496.37°C (rough estimate) |
| Density | 1.2985 (rough estimate) |
| refractive index | 1.5614 (estimate) |
| storage temp. | Desiccate at -20°C |
| solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly, Sonicated), Methanol (Slightly) |
| form | Solid |
| color | Light Yellow to Dark Orange |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C21H18NO4/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22/h4-10H,11H2,1-3H3/q+1 |
| InChIKey | LLEJIEBFSOEYIV-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC2=C(C(OC)=CC=C2C2C=CC3C=C4OCOC4=CC=3C1=2)OC |
| LogP | -0.401 (est) |
| CAS DataBase Reference | 34316-15-9(CAS DataBase Reference) |
Description and Uses
Chelerythrine Chloride is a cell permeable protein kinase C (PKC) inhibitor.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H300-H315-H319-H335 |
| Precautionary statements | P261-P264-P301+P310+P330-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |





