A2317112
2-Chloro-3-pyridinecarboxaldehyde , 97% , 36404-88-3
Synonym(s):
Chloro-2-formyl-3-pyridine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-54 °C (lit.) |
| Boiling point: | 119 °C(Press: 30 Torr) |
| Density | 1.332±0.06 g/cm3(Predicted) |
| Flash point: | >230 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, DMSO |
| pka | -1.36±0.10(Predicted) |
| form | Powder or Low Melting Solid |
| color | White to off-white |
| InChI | InChI=1S/C6H4ClNO/c7-6-5(4-9)2-1-3-8-6/h1-4H |
| InChIKey | KHPAGGHFIDLUMB-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC=C1C=O |
| CAS DataBase Reference | 36404-88-3(CAS DataBase Reference) |
Description and Uses
Azaindazole intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |




