A2320712
2-Chloroacrylonitrile , 99% , 920-37-6
CAS NO.:920-37-6
Empirical Formula: C3H2ClN
Molecular Weight: 87.51
MDL number: MFCD00001858
EINECS: 213-055-2
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB48.80 | In Stock |
|
| 100ML | RMB145.60 | In Stock |
|
| 500ML | RMB494.40 | In Stock |
|
| 2.5L | RMB1791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −65 °C(lit.) |
| Boiling point: | 88-89 °C(lit.) |
| Density | 1.096 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 44 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Ethyl Acetate, Methanol (Very Slightly) |
| form | Liquid |
| color | Clear colorless to yellow |
| BRN | 773744 |
| InChI | InChI=1S/C3H2ClN/c1-3(4)2-5/h1H2 |
| InChIKey | OYUNTGBISCIYPW-UHFFFAOYSA-N |
| SMILES | C(#N)C(Cl)=C |
| CAS DataBase Reference | 920-37-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenenitrile, 2-chloro-(920-37-6) |
| EPA Substance Registry System | 2-Chloroacrylonitrile (920-37-6) |
Description and Uses
Common reagent in cycloaddition reactions.1,2
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() ![]() GHS02,GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H300+H330-H311-H314-H334-H350-H400 |
| Precautionary statements | P210-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | F,T+,T,N |
| Risk Statements | 45-24-26/28-34-43-50-40-36/37/38-28-23/24-11 |
| Safety Statements | 53-26-36/37/39-45-61-28A-16-1-28 |
| RIDADR | UN 3383 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | AT5525000 |
| Hazard Note | Flammable/Very Toxic |
| TSCA | TSCA listed |
| HazardClass | 3.1 |
| PackingGroup | II |
| HS Code | 29269095 |
| Excepted Quantities | Forbidden |









