A2321312
6-Chloro-2-hexanone , 98% , 10226-30-9
CAS NO.:10226-30-9
Empirical Formula: C6H11ClO
Molecular Weight: 134.6
MDL number: MFCD00191625
EINECS: 233-546-5
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB132.00 | In Stock |
|
| 25ML | RMB453.60 | In Stock |
|
| 100ml | RMB1269.60 | In Stock |
|
| 250ml | RMB2535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85.5-86.5 °C/16 mmHg (lit.) |
| Density | 1.02 g/mL at 25 °C (lit.) |
| vapor pressure | 1.29-1.607hPa at 25℃ |
| refractive index | n |
| Flash point: | 195 °F |
| storage temp. | Freezer |
| form | Liquid |
| Specific Gravity | 1.03 |
| color | Clear yellow to brown |
| Water Solubility | Insoluble in water, soluble in chloroform (chloroform, carbon), n-heptane, ethanol, butanol, etc. |
| InChI | InChI=1S/C6H11ClO/c1-6(8)4-2-3-5-7/h2-5H2,1H3 |
| InChIKey | CMDIDTNMHQUVPE-UHFFFAOYSA-N |
| SMILES | CC(=O)CCCCCl |
| LogP | 1.43-1.492 at 20-25℃ |
| CAS DataBase Reference | 10226-30-9(CAS DataBase Reference) |
Description and Uses
6-Chloro-2-hexanone in the synthesis of the keto analogs began with 6-chloro-2-hexanone. Substituted 7-(oxoalkyl)theophyllines were synthesized by alkylation of the respective theophyllines with 6-chloro-2-hexanone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501-P210e-P261-P280a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 37/39-26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 29141990 |






