A2321912
(S)-4-Chloro-3-hydroxybutyric Acid Ethyl Ester , 96% , 86728-85-0
CAS NO.:86728-85-0
Empirical Formula: C6H11ClO3
Molecular Weight: 166.6
MDL number: MFCD00211241
EINECS: 617-912-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB145.60 | In Stock |
|
| 100G | RMB445.60 | In Stock |
|
| 500g | RMB744.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -14.5 º (c=neat) |
| Boiling point: | 93-95 °C5 mm Hg(lit.) |
| Density | 1.19 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 109 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 13.23±0.20(Predicted) |
| form | Liquid |
| color | Clear colorless to yellow |
| optical activity | [α]23/D 14°, neat |
| BRN | 4657170 |
| InChI | InChI=1S/C6H11ClO3/c1-2-10-6(9)3-5(8)4-7/h5,8H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | ZAJNMXDBJKCCAT-YFKPBYRVSA-N |
| SMILES | C(OCC)(=O)C[C@H](O)CCl |
| CAS DataBase Reference | 86728-85-0(CAS DataBase Reference) |
Description and Uses
Ethyl (S)-(?)-4-chloro-3-hydroxybutyrate can be used as a starting material in the synthesis of 4-amino-3-hydroxybutyric acid, a compound of pharmacological importance.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 41-22 |
| Safety Statements | 26-36-39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29181990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







![(3R)-3-[4-[(5-Bromo-2-chlorophenyl)methyl]phenoxy]tetrahydrofuran](https://img.chemicalbook.com/CAS/20150408/GIF/915095-90-8.gif)
![(3R,4S,5S,6R)-2-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol](https://img.chemicalbook.com/CAS/20180808/GIF/915095-96-4.gif)