A2998312
(2-Chloro-5-iodophenyl)(4-fluorophenyl)methanone , 98% , 915095-86-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25G | RMB439.20 | In Stock |
|
| 100g | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-70℃ |
| Boiling point: | 415℃ |
| Density | 1.752 |
| Flash point: | 205℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Ethyl Acetate |
| form | Solid |
| color | Off-White |
| InChI | InChI=1S/C13H7ClFIO/c14-12-6-5-10(16)7-11(12)13(17)8-1-3-9(15)4-2-8/h1-7H |
| InChIKey | KNYGUQLVFSPVRI-UHFFFAOYSA-N |
| SMILES | C(C1=CC(I)=CC=C1Cl)(C1=CC=C(F)C=C1)=O |
Description and Uses
(2-Chloro-5-iodophenyl)(4-fluorophenyl)methanone is a reagent in the synthesis of Empagliflozin (E521510); an inhibitor of SGLT-2.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| HS Code | 29142990 |




![(3S)-3-{4-[(2-chloro-5-iodophenyl)methyl]phenoxy}oxolane](https://img.chemicalbook.com/CAS/20150408/GIF/915095-94-2.gif)


