A2322112
Methyl 4-Chlorobutyrate , 98% , 3153-37-5
CAS NO.:3153-37-5
Empirical Formula: C5H9ClO2
Molecular Weight: 136.58
MDL number: MFCD00001003
EINECS: 221-592-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB36.80 | In Stock |
|
| 100G | RMB89.60 | In Stock |
|
| 500G | RMB361.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 175-176 °C (lit.) |
| Density | 1.12 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 139 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| Specific Gravity | 1.120 |
| color | Clear colorless |
| Water Solubility | Slightly soluble in water. |
| BRN | 1745117 |
| InChI | InChI=1S/C5H9ClO2/c1-8-5(7)3-2-4-6/h2-4H2,1H3 |
| InChIKey | ZZUYIRISBMWFMV-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CCCCl |
| LogP | 1.160 (est) |
| CAS DataBase Reference | 3153-37-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 4-chlorobutyrate(3153-37-5) |
| EPA Substance Registry System | Butanoic acid, 4-chloro-, methyl ester (3153-37-5) |
Description and Uses
Methyl 4-chlorobutyrate is used as a pharmaceutical synthesis, industrial dye intermediates.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H226 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P280-P303+P361+P353-P403+P235-P501-P261-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29159080 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





