A2335112
Cinchonidine , 98% , 485-71-2
Synonym(s):
(−)-Cinchonidine;Cinchonidine
CAS NO.:485-71-2
Empirical Formula: C19H22N2O
Molecular Weight: 294.39
MDL number: MFCD00006783
EINECS: 207-622-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB84.00 | In Stock |
|
| 25G | RMB280.80 | In Stock |
|
| 100g | RMB1592.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-206 °C(lit.) |
| Boiling point: | 436.16°C (rough estimate) |
| alpha | -115 º (c=1, EtOH) |
| Density | 1.0863 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | -107.5 ° (C=1, EtOH) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | 0.25g/l |
| form | Crystalline Powder |
| pka | 5.80, 10.03(at 25℃) |
| color | White to cream |
| PH | 9 (0.2g/l, H2O, 20℃) |
| optical activity | [α]23/D 109.2°, c = 1.5 in ethanol |
| Water Solubility | Insoluble |
| Sensitive | Light Sensitive |
| Merck | 14,2286 |
| BRN | 89690 |
| Stability: | Stable, but light-sensitive. Incompatible with strong oxidizing agents. |
| InChI | 1S/C19H22N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,9,13-14,18-19,22H,1,8,10-12H2/t13-,14-,18-,19+/m0/s1 |
| InChIKey | KMPWYEUPVWOPIM-NAHPKXJFSA-N |
| SMILES | O[C@@H]([C@@H]1C[C@@H]2CCN1C[C@@H]2C=C)c3ccnc4ccccc34 |
| LogP | 2.68 at 25℃ |
| CAS DataBase Reference | 485-71-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Cinchonidine(485-71-2) |
| EPA Substance Registry System | Cinchonan-9-ol, (8.alpha.,9R)- (485-71-2) |
Description and Uses
antiamebic, antiprotozoal
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-42/43-36/37/38-20/22-48/22-43-22-63 |
| Safety Statements | 22-24/25-36/37-36-26 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | GD2975000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29392900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1A |
| Toxicity | LD50 i.p. in rats: 206 mg/kg (Johnson, Poe); LD50 orally in quail: >316 mg/kg (Schafer) |






