A6949158
(+)-Cinchonine , 10mMinDMSO , 118-10-5
Synonym(s):
(+)-Cinchonine;Cinchonine;Cinchonine monohydrochloride dihydrate;NSC 6176
CAS NO.:118-10-5
Empirical Formula: C19H22N2O
Molecular Weight: 294.39
MDL number: MFCD00064372
EINECS: 204-234-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 260-263 °C |
| alpha | 224 º (c=0.5, alcohol) |
| Boiling point: | 436.16°C (rough estimate) |
| Density | 1.0863 (rough estimate) |
| bulk density | 130kg/m3 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 223 ° (C=0.5, EtOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | 0.25g/l |
| form | Micro-Crystalline Powder |
| pka | 5.85, 9.92(at 25℃) |
| color | White to light beige |
| PH | 9.0 (0.25g/l, H2O, 20℃)(as aqueous solution) |
| optical activity | [α]23/D +228°, c = 0.5 in ethanol |
| Water Solubility | Insoluble |
| Sensitive | Light Sensitive |
| Merck | 14,2287 |
| BRN | 89689 |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| InChI | 1S/C19H22N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,9,13-14,18-19,22H,1,8,10-12H2/t13-,14-,18+,19-/m0/s1 |
| InChIKey | KMPWYEUPVWOPIM-QHQSXHFQSA-N |
| SMILES | N21[C@H](C[C@@H]([C@H](C2)C=C)CC1)[C@@H](O)c3c4c(ncc3)cccc4 |
| LogP | 2.82 at 25℃ |
| CAS DataBase Reference | 118-10-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Cinchonine(118-10-5) |
| EPA Substance Registry System | Cinchonan-9-ol, (9S)- (118-10-5) |
Description and Uses
Cinchonine is a cinchona alkaloid generally found in the bark of Cinchona officinalis plants. It is a pseudoenantiomer that is commonly employed in malaria therapy. Cinchonine is also used as an organocatalyst in many asymmetric reactions. It is a stereoisomer and pseudo-enantiomer of cinchonidine. It is structurally similar to quinine, an antimalarial drug.
Stereomeric with Cinchonidine (C441925). Antimalarial.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P261-P264-P270-P280-P301+P312-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | 20/22-20/21/22 |
| Safety Statements | 26-36-36/37 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | GD3500000 |
| F | 8-34 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| Toxicity | LD50 i.p. in rats: 152 mg/kg (Johnson, Poe) |







