A2351712
Dacthal , Analysis standard , 1861-32-1
Synonym(s):
DCPA;Dimethyl tetrachloroterephthalate
CAS NO.：1861-32-1
Empirical Formula: C10H6Cl4O4
Molecular Weight: 331.96
MDL number: MFCD00014902
EINECS: 217-464-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-156°C |
| Boiling point: | 448.04°C (rough estimate) |
| Density | 1.6496 (rough estimate) |
| refractive index | 1.5282 (estimate) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Yellow to Pale Beige |
| Water Solubility | 0.05 g/100 mL |
| Merck | 14,2839 |
| BRN | 1888840 |
| InChI | InChI=1S/C10H6Cl4O4/c1-17-9(15)3-5(11)7(13)4(10(16)18-2)8(14)6(3)12/h1-2H3 |
| InChIKey | NPOJQCVWMSKXDN-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=C(Cl)C(Cl)=C(C(OC)=O)C(Cl)=C1Cl |
| CAS DataBase Reference | 1861-32-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3,5,6-Tetrachloro-1,4-benzenedicarboxylic acid dimethyl ester(1861-32-1) |
| EPA Substance Registry System | Chlorthal-dimethyl (1861-32-1) |
Description and Uses
Selective, nonsystemic, preemergent herbicide to control most annual grasses and many broad-leaved weeds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H303 |
| Precautionary statements | P270-P301+P312-P403-P501c |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | WZ1500000 |
| HS Code | 29173990 |
| Hazardous Substances Data | 1861-32-1(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >3000 mg/kg (Bailey, White) |
