Chlorthal-dimethyl , 96% , 1861-32-1
Synonym(s):
DCPA;Dimethyl tetrachloroterephthalate
CAS NO.:1861-32-1
Empirical Formula: C10H6Cl4O4
Molecular Weight: 331.96
MDL number: MFCD00014902
EINECS: 217-464-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB61.60 | In Stock |
|
| 25G | RMB83.20 | In Stock |
|
| 100G | RMB184.00 | In Stock |
|
| 500G | RMB494.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 155-156°C |
| Boiling point: | 448.04°C (rough estimate) |
| Density | 1.6496 (rough estimate) |
| refractive index | 1.5282 (estimate) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Yellow to Pale Beige |
| Water Solubility | 0.05 g/100 mL |
| Merck | 14,2839 |
| BRN | 1888840 |
| Henry's Law Constant | 4.4×100 mol/(m3Pa) at 25℃, Muir et al. (2004) |
| InChI | InChI=1S/C10H6Cl4O4/c1-17-9(15)3-5(11)7(13)4(10(16)18-2)8(14)6(3)12/h1-2H3 |
| InChIKey | NPOJQCVWMSKXDN-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=C(Cl)C(Cl)=C(C(OC)=O)C(Cl)=C1Cl |
| CAS DataBase Reference | 1861-32-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3,5,6-Tetrachloro-1,4-benzenedicarboxylic acid dimethyl ester(1861-32-1) |
| EPA Substance Registry System | Chlorthal-dimethyl (1861-32-1) |
Description and Uses
Chlorthal-dimethyl is a selective benzoic acid herbicide. It has a low aqueous solubility and a low to moderate volatility. It is considered to be moderately persistent in soil systems but can be stable in aquatic systems depending upon conditions. Based on its physico-chemical properties it is not expected to leach to groundwater. Its toxicity to fauna and flora is low to medium. It also has a low mammalian toxicity and no evidence has been found that suggests it will cause serious adverse health effects unless exposure is high.
Selective, nonsystemic, preemergent herbicide to control most annual grasses and many broad-leaved weeds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H303 |
| Precautionary statements | P270-P301+P312-P403-P501c |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | WZ1500000 |
| HS Code | 29173990 |
| Hazardous Substances Data | 1861-32-1(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >3000 mg/kg (Bailey, White) |




