A2365912
Chlorotripyrrolidinophosphonium hexafluorophosphate , 98% , 133894-48-1
Synonym(s):
PyCloP
CAS NO.:133894-48-1
Empirical Formula: C12H24ClF6N3P2
Molecular Weight: 421.73
MDL number: MFCD00210035
EINECS: 628-539-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB264.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-148°C |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Methanol |
| form | Crystalline Powder |
| color | White to yellow |
| Sensitive | Moisture Sensitive |
| BRN | 6842341 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C12H24ClN3P.F6P/c13-17(14-7-1-2-8-14,15-9-3-4-10-15)16-11-5-6-12-16;1-7(2,3,4,5)6/h1-12H2;/q+1;-1 |
| InChIKey | BSCYRXJVGSZNKX-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[P+](N1CCCC1)(N1CCCC1)(N1CCCC1)Cl |
| CAS DataBase Reference | 133894-48-1(CAS DataBase Reference) |
Description and Uses
Crystalline reagent for peptide coupling of a-alkylated N-Fmoc and N-Z-amino acids in high yield and without racemization.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H314 |
| Precautionary statements | P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501-P280-P305+P351+P338-P310-P260h-P301+P330+P331-P303+P361+P353-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 26-36-45-36/37/39 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29339900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |




