A0652212
Ammonium hexafluorophosphate , 99.5% , 16941-11-0
Synonym(s):
Azanium hexafluorophosphate
CAS NO.:16941-11-0
Empirical Formula: F6H4NP
Molecular Weight: 163
MDL number: MFCD00064642
EINECS: 241-009-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5g | RMB68.80 | In Stock |
|
| 25G | RMB220.00 | In Stock |
|
| 100G | RMB720.00 | In Stock |
|
| 250g | RMB1599.20 | In Stock |
|
| 500g | RMB2775.20 | In Stock |
|
| 1kg | RMB4919.20 | In Stock |
|
| 2.5kg | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58 °C (lit.) |
| Density | 2.18 g/mL at 25 °C (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | Crystalline Powder or Needles |
| Specific Gravity | 2.180 |
| color | White to beige |
| Water Solubility | 74.8 g/100 mL (20 ºC) |
| Sensitive | Hygroscopic |
| Merck | 14,526 |
| Stability: | Stable. Incompatible with strong acids. Hygroscopic. Combustion may generate hydrogen fluoride, phosphorus oxides, phosphine or ammonia. |
| Cosmetics Ingredients Functions | BUFFERING |
| InChI | InChI=1S/F6P.H3N/c1-7(2,3,4,5)6;/h;1H3/q-1;/p+1 |
| InChIKey | NIZXKAYXSNUDOU-UHFFFAOYSA-O |
| SMILES | [NH4+].[P-](F)(F)(F)(F)(F)F |
| CAS DataBase Reference | 16941-11-0(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphate(1-), hexafluoro-, ammonium (16941-11-0) |
Description and Uses
Ammonium hexafluorophosphate (NH4PF6) can be used as a precursor for the preparation of:
- Metal complexes, particularly iridium and rhodium complexes.???????
- Flame retardant cellulose-based materials.???????
- Cyclic amidinium and iminium ammonium hexafluorophosphate salts.????????
- The polymer-supported iridium isomerization catalyst for the selective trans isomerization of aryl allylic derivatives.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3260 8/PG 2 |
| WGK Germany | 3 |
| F | 3 |
| Hazard Note | Corrosive/Hygroscopic |
| TSCA | T |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 28269090 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






![N-(2-Chloro-6-methylphenyl)-2-[(6-chloro-2-methyl-4-pyrimidinyl)amino]-5-thiazolecarboxamide](https://img.chemicalbook.com/CAS/GIF/302964-08-5.gif)