A2369012
Cyclopentylacetic acid , 98% , 1123-00-8
Synonym(s):
Cyclopentaneacetic acid
CAS NO.：1123-00-8
Empirical Formula: C7H12O2
Molecular Weight: 128.17
MDL number: MFCD00001387
EINECS: 214-368-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB214.56 | In Stock |
|
| 25G | RMB711.36 | In Stock |
|
| 100G | RMB2792.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 12-14°C |
| Boiling point: | 133-134 °C/23 mmHg (lit.) |
| Density | 1.022 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 229 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform, Methanol |
| form | Liquid |
| pka | 4.85±0.10(Predicted) |
| color | Clear colorless |
| BRN | 2040821 |
| InChI | InChI=1S/C7H12O2/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2,(H,8,9) |
| InChIKey | YVHAIVPPUIZFBA-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)CCCC1 |
| CAS DataBase Reference | 1123-00-8(CAS DataBase Reference) |
Description and Uses
Cyclopentylacetic acid has been used in a study to examine the butylation efficiency of free carboxylic acids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29162090 |
