BD0978132
1-Cyclopentylethanone , 98% , 6004-60-0
CAS NO.：6004-60-0
Empirical Formula: C7H12O
Molecular Weight: 112.17
MDL number: MFCD00060799
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB37.60 | In Stock |
|
| 5g | RMB123.20 | In Stock |
|
| 10g | RMB236.00 | In Stock |
|
| 25g | RMB396.80 | In Stock |
|
| 100g | RMB1182.40 | In Stock |
|
| 500g | RMB5829.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 151-156℃ |
| Density | 0.913 |
| refractive index | 1.4435 |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Miscible with water. |
| InChI | InChI=1S/C7H12O/c1-6(8)7-4-2-3-5-7/h7H,2-5H2,1H3 |
| InChIKey | LKENTYLPIUIMFG-UHFFFAOYSA-N |
| SMILES | C(=O)(C1CCCC1)C |
| LogP | 1.340 (est) |
| NIST Chemistry Reference | Ethanone, 1-cyclopentyl-(6004-60-0) |
Description and Uses
Cyclopentyl methyl ketone acts as a ligand for Suzuki coupling. Further, it reacts with benzo[1,2,5]oxadiazole 1-oxide to prepare 3-methylspiro(chinoxalin-2(3H),1'-cyclopentan)-3-amin-1,4-dioxide.
