A2370312
Chlorhexidine dihydrochloride , 98% , 3697-42-5
Synonym(s):
1,6-Bis(N5-[p-chlorophenyl]-N1-biguanido)hexane; 1,1′-Hexamethylenebis(5-[p-chlorophenyl]biguanide);Chlorhexidine dihydrochloride;Lisium
CAS NO.：3697-42-5
Empirical Formula: C22H32Cl4N10
Molecular Weight: 578.37
MDL number: MFCD00068998
EINECS: 223-026-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB56.00 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB498.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-116 °C |
| Density | 1.284[at 20℃] |
| vapor pressure | 0.003Pa at 25℃ |
| storage temp. | 2-8°C |
| solubility | Sparingly soluble in water and in propylene glycol, very slightly soluble in ethanol (96 per cent). |
| form | Solid |
| color | White to Off-White |
| Odor | odorless |
| Water Solubility | 0.06 g/100 mL (20 ºC) |
| Merck | 14,2091 |
| InChIKey | WJLVQTJZDCGNJN-UHFFFAOYSA-N |
| SMILES | C1(C=CC(Cl)=CC=1)NC(=N)NC(=N)NCCCCCCNC(=N)NC(=N)NC1C=CC(Cl)=CC=1.Cl.Cl |
| LogP | -1.94 at 22.2℃ |
| EPA Substance Registry System | Chlorhexidine dihydrochloride (3697-42-5) |
Description and Uses
chlorhexidine dihydrochloride is a preservative, it functions primarily as an anti-microbial, helping control the proliferation of bacteria, fungi, or yeast in a product.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H410 |
| Precautionary statements | P264-P273-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P391-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 53-45-61-36-26 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | MA4375000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29252900 |
