A2370512
(-)-Camphanic acid , 99% , 13429-83-9
Synonym(s):
(−)-Camphanic acid;(1S)-3-Oxo-4,7,7-trimethyl-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid
CAS NO.:13429-83-9
Empirical Formula: C10H14O4
Molecular Weight: 198.22
MDL number: MFCD00044948
EINECS: 236-552-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB367.20 | In Stock |
|
| 100G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 201-205 °C |
| Boiling point: | 255.53°C (rough estimate) |
| alpha | -18.5 º (c=1, dioxane) |
| Density | 1.0143 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.36±0.60(Predicted) |
| form | powder to crystaline |
| color | White to Almost white |
| optical activity | [α]20/D 18°, c = 1 in dioxane |
| BRN | 84570 |
| InChI | InChI=1S/C10H14O4/c1-8(2)9(3)4-5-10(8,6(11)12)14-7(9)13/h4-5H2,1-3H3,(H,11,12)/t9-,10+/m0/s1 |
| InChIKey | RKFCLVFAFZYVCG-WDEREUQCSA-N |
| SMILES | [C@@]12(C(O)=O)C(C)(C)[C@@](C)(CC1)C(=O)O2 |
| CAS DataBase Reference | 13429-83-9(CAS DataBase Reference) |
Description and Uses
(1S)-(-)-Camphanic acid may be used in the preparation of (-)-(1S,4R)-camphanoyl chloride by reacting with thionyl chloride.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-37/39-26-36-37 |
| WGK Germany | 3 |
| HS Code | 29329995 |
| Storage Class | 13 - Non Combustible Solids |



