PRODUCT Properties
| Melting point: | 45.5-46.5°C |
| Boiling point: | 347.3±52.0 °C(Predicted) |
| Density | 1.64 g/cm3(Temp: 23 °C) |
| Flash point: | >100 °C |
| storage temp. | APPROX 4°C |
| solubility | Chloroform: Slightly Soluble |
| form | Crystalline Solid |
| pka | -5.59±0.10(Predicted) |
| color | Amber |
| Water Solubility | 4mg/L(25 ºC) |
| Merck | 13,2208 |
| BRN | 1541078 |
| Major Application | agriculture environmental |
| InChI | 1S/C7H7Cl3NO3PS/c1-12-15(16,13-2)14-7-5(9)3-4(8)6(10)11-7/h3H,1-2H3 |
| InChIKey | HRBKVYFZANMGRE-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1nc(Cl)c(Cl)cc1Cl |
| CAS DataBase Reference | 5598-13-0(CAS DataBase Reference) |
| NIST Chemistry Reference | o,o-Dimethyl-o-(3,5,6-trichloro-2-pyridyl)phosphorothioate(5598-13-0) |
| EPA Substance Registry System | Chlorpyrifos-methyl (5598-13-0) |
Description and Uses
Chlorpyrifos-methyl is a general use organophosphate insecticide registered in 1985. It is used for the control of stored grain pests, weevils, moths, borers, beetles and mealworms, red flour beetle, and grain moth; for seed treatment; and for warehouse. It is effective against rice stem borer, aphids, cutworms, plant and leaf hoppers, mole crickets and some moths, and stored grain pests. It is poorly soluble in water, moderately soluble in hexane and alcohols, and readily soluble in other organic solvents such as acetone, benzene, and chloroform.
Chlorpyriphos-methyl is an derivative of Chlorpyrifos (C425300), an insecticide that acts on the nervous system of insects by inhibiting acetylcholinesterase.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H317-H331-H410 |
| Precautionary statements | P261-P273-P280-P301+P312-P302+P352-P304+P340+P311 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi;N,N,Xi,Xn,F |
| Risk Statements | 43-50/53-36-20/21/22-11 |
| Safety Statements | 36/37-60-61-36-26-16 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| RTECS | TG0700000 |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Hazardous Substances Data | 5598-13-0(Hazardous Substances Data) |





