A2377512
4′-(Octyloxy)-4-biphenylcarbonitrile , 98% , 52364-73-5
Synonym(s):
4′-(Octyloxy)-4-biphenylcarbonitrile;4′-(Octyloxy)-4-cyanobiphenyl;4′-Octyloxy-1,1′-biphenyl-4-carbonitrile;4-(4-Octyloxyphenyl)benzonitrile;4-(Octyloxy)-4′-cyanobiphenyl
CAS NO.:52364-73-5
Empirical Formula: C21H25NO
Molecular Weight: 307.43
MDL number: MFCD00075145
EINECS: 257-878-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB50.40 | In Stock |
|
| 5G | RMB202.40 | In Stock |
|
| 10G | RMB355.20 | In Stock |
|
| 25G | RMB614.40 | In Stock |
|
| 100G | RMB1722.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-77 °C (lit.) |
| Boiling point: | 447.93°C (rough estimate) |
| Density | 1.0505 (rough estimate) |
| refractive index | 1.5614 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid crystal (Nematic) |
| color | White to Almost white |
| InChI | InChI=1S/C21H25NO/c1-2-3-4-5-6-7-16-23-21-14-12-20(13-15-21)19-10-8-18(17-22)9-11-19/h8-15H,2-7,16H2,1H3 |
| InChIKey | GPGGNNIMKOVSAG-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OCCCCCCCC)C=C2)=CC=C(C#N)C=C1 |
| NIST Chemistry Reference | Octyloxycyanobiphenyl(52364-73-5) |
| EPA Substance Registry System | [1,1'-Biphenyl]-4-carbonitrile, 4'-(octyloxy)- (52364-73-5) |
Description and Uses
8CB may be used in the preparation of asymmetrical zinc phthalocyanine (aZnPc)-functional photocurable copolymer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P273-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DV1764500 |
| TSCA | TSCA listed |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |



