A2379012
2-Chloro-6-methoxypyridine , 97% , 17228-64-7
CAS NO.：17228-64-7
Empirical Formula: C6H6ClNO
Molecular Weight: 143.57
MDL number: MFCD00006265
EINECS: 241-264-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB66.40 | In Stock |
|
| 100G | RMB223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 185-186 °C (lit.) |
| Density | 1.207 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 169 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 0.40±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 1364500 |
| InChI | InChI=1S/C6H6ClNO/c1-9-6-4-2-3-5(7)8-6/h2-4H,1H3 |
| InChIKey | VAVGOGHLNAJECD-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(OC)=CC=C1 |
| CAS DataBase Reference | 17228-64-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 2-chloro-6-methoxy-(17228-64-7) |
Description and Uses
2-Chloro-6-methoxy-pyridine is a reagent used to synthesize imidazo[1,2-a]pyrimidines as functionally selective GABAA ligands. It can also be used to synthesize oxazolidinedione-arylpyridinones as EP3 receptor antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| PackingGroup | III |
| HS Code | 29333990 |
