A2379312
2-Chloro-4-nitro-1H-imidazole , 95% , 57531-37-0
CAS NO.：57531-37-0
Empirical Formula: C3H2ClN3O2
Molecular Weight: 147.52
MDL number: MFCD03419295
EINECS: 611-554-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB44.00 | In Stock |
|
| 1G | RMB106.40 | In Stock |
|
| 5G | RMB463.20 | In Stock |
|
| 25G | RMB1916.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216-217 °C |
| Boiling point: | 386.8±34.0 °C(Predicted) |
| Density | 1.740±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Sonicated) |
| pka | 5.65±0.10(Predicted) |
| form | Solid |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C3H2ClN3O2/c4-3-5-1-2(6-3)7(8)9/h1H,(H,5,6) |
| InChIKey | BOJZBRDIZUHTCE-UHFFFAOYSA-N |
| SMILES | C1(Cl)NC([N+]([O-])=O)=CN=1 |
| CAS DataBase Reference | 57531-37-0(CAS DataBase Reference) |
Description and Uses
4-Nitroimidazole derivative with poetenial use as radiosensitizers of hypoxic cells. 2-Chloro-4-nitroimidazole is used in the preparation of antitubercular nitroimidazoles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HazardClass | IRRITANT |
| HS Code | 2933299090 |
