A2385312
4-Chloro-DL-phenylalanine methyl ester hydrochloride , 98% , 14173-40-1
CAS NO.:14173-40-1
Empirical Formula: C10H13Cl2NO2
Molecular Weight: 250.12
MDL number: MFCD00012530
EINECS: 238-024-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB200.80 | In Stock |
|
| 5G | RMB309.60 | In Stock |
|
| 25G | RMB1142.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-189 °C(lit.) |
| storage temp. | -20°C |
| solubility | Soluble to 100 mM in water and to 100 mM in DMSO |
| form | Solid |
| color | White to off-white |
| InChI | 1S/C10H12ClNO2.ClH/c1-14-10(13)9(12)6-7-2-4-8(11)5-3-7;/h2-5,9H,6,12H2,1H3;1H |
| InChIKey | GCBCWTWQAFLKJG-UHFFFAOYSA-N |
| SMILES | Cl.COC(=O)C(N)Cc1ccc(Cl)cc1 |
| CAS DataBase Reference | 14173-40-1(CAS DataBase Reference) |
Description and Uses
4-Chloro-DL-phenylalanine methyl ester hydrochloride has been used to induce 5-hydroxytryptamine (5-HT) depletion in rats.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Warning |
| Hazard statements | H314 |
| Precautionary statements | P264b-P271-P280-P301+P330+P331-P304+P340-P305+P351+P338-P310-P363-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | AY4452100 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |






