BD0351245
H-DL-Phe-OMe.HCl , 98% , 5619-07-8
CAS NO.：5619-07-8
Empirical Formula: C10H14ClNO2
Molecular Weight: 215.68
MDL number: MFCD00066113
EINECS: 227-049-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB33.60 | In Stock |
|
| 25g | RMB59.20 | In Stock |
|
| 100g | RMB228.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-162°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Solid |
| color | Off-White to Pale Grey |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3597947 |
| InChI | InChI=1S/C10H13NO2.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H |
| InChIKey | SWVMLNPDTIFDDY-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1)CC(N)C(=O)OC.Cl |
| CAS DataBase Reference | 5619-07-8(CAS DataBase Reference) |
Description and Uses
DL-Phenylalanine methyl ester hydrochloride, is an aminoacid which is widely used in pharmaceuticals and foods.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
