A2385412
N-(Carbobenzyloxy)-D-phenylalaninol , 97% , 58917-85-4
Synonym(s):
(R)-(+)-2-(Carbobenzyloxyamino)-3-phenyl-1-propanol;(R)-2-(Z-Amino)-3-phenyl-1-propanol;N-(Carbobenzyloxy)-D -phenylalaninol
CAS NO.:58917-85-4
Empirical Formula: C17H19NO3
Molecular Weight: 285.34
MDL number: MFCD00191193
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB149.76 | In Stock |
|
| 25G | RMB450.72 | In Stock |
|
| 100g | RMB1736.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-95 °C |
| alpha | 30 º (c=1 in chloroform) |
| Boiling point: | 427.77°C (rough estimate) |
| Density | 1.0864 (rough estimate) |
| refractive index | 42 ° (C=2, MeOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| pka | 11.86±0.46(Predicted) |
| color | White |
| optical activity | [α]22/D +30°, c = 1 in chloroform |
| BRN | 2221968 |
| Major Application | peptide synthesis |
| InChI | 1S/C17H19NO3/c19-12-16(11-14-7-3-1-4-8-14)18-17(20)21-13-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,18,20)/t16-/m1/s1 |
| InChIKey | WPOFMMJJCPZPAO-MRXNPFEDSA-N |
| SMILES | OC[C@@H](Cc1ccccc1)NC(=O)OCc2ccccc2 |
| CAS DataBase Reference | 58917-85-4(CAS DataBase Reference) |
Description and Uses
Z-D-Phenylalaninol is used in the synthesis of aminophenylpropanyl phosphate derivatives which has pin1 inhibitory activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29051990 |
| Storage Class | 11 - Combustible Solids |







