A8454012
Z-Gln-OH , 98% , 2650-64-8
Synonym(s):
N-Cbz-L -glutamine;Carbobenzyloxy-L -glutamine;Z-L -Glutamine
CAS NO.:2650-64-8
Empirical Formula: C13H16N2O5
Molecular Weight: 280.28
MDL number: MFCD00008043
EINECS: 220-173-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB197.60 | In Stock |
|
| 250G | RMB469.60 | In Stock |
|
| 500g | RMB921.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-138 °C(lit.) |
| Boiling point: | 423°C (rough estimate) |
| alpha | -7 º (c=2, EtOH) |
| Density | 1.2419 (rough estimate) |
| refractive index | 1.6450 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Ethanol, Methanol |
| form | Solid |
| pka | 3.82±0.10(Predicted) |
| color | White |
| optical activity | [α]23/D 7.3°, c = 2 in ethanol |
| BRN | 2061271 |
| Major Application | peptide synthesis |
| InChI | 1S/C13H16N2O5/c14-11(16)7-6-10(12(17)18)15-13(19)20-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,14,16)(H,15,19)(H,17,18)/t10-/m0/s1 |
| InChIKey | JIMLDJNLXLMGLX-JTQLQIEISA-N |
| SMILES | NC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 2650-64-8(CAS DataBase Reference) |
| EPA Substance Registry System | L-Glutamine, N2-[(phenylmethoxy)carbonyl]- (2650-64-8) |
Description and Uses
N-Carbobenzyloxy-L-glutamine has use an anti-ulcer agent. Also an inhibitor for AHAS (Acetohydroxy Acid Synthase) an important enzyme which will affect how benign an environmental herbicid e is. Also used in the synthesis of neomycin B, an important HIV antiviral agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







