A2389212
2-Chloro-6-nitrotoluene , 99% , 83-42-1
CAS NO.:83-42-1
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD00007205
EINECS: 201-475-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB42.40 | In Stock |
|
| 100G | RMB128.00 | In Stock |
|
| 500G | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-36 °C (lit.) |
| Boiling point: | 238 °C (lit.) |
| Density | 1.3246 (rough estimate) |
| vapor pressure | 2-770Pa at 20-100℃ |
| refractive index | 1.5377 (estimate) |
| Flash point: | 257 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 0.092g/l |
| form | Crystalline |
| color | White to Orange to Green |
| Water Solubility | 92 mg/L (20 ºC) |
| BRN | 1239924 |
| InChI | 1S/C7H6ClNO2/c1-5-6(8)3-2-4-7(5)9(10)11/h2-4H,1H3 |
| InChIKey | XCSNRORTQRKCHB-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)cccc1[N+]([O-])=O |
| LogP | 3.09 |
| CAS DataBase Reference | 83-42-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-2-methyl-3-nitro-(83-42-1) |
| EPA Substance Registry System | 1-Chloro-2-methyl-3-nitrobenzene (83-42-1) |
Description and Uses
2-Chloro-6-nitrotoluene is used as a reagent in the synthesis of 3-Chloro-2-methylaniline (C367805); a herbicide intermediate.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H411 |
| Precautionary statements | P273-P391-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi,N |
| Risk Statements | 22-36/37/38-20/21/22-52/53 |
| Safety Statements | 36/37/39-26-61 |
| RIDADR | UN 3457 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | XS9130000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




