A2398912
5-Chloro-2-oxindole , 98% , 17630-75-0
Synonym(s):
5-Chlorooxindole
CAS NO.:17630-75-0
Empirical Formula: C8H6ClNO
Molecular Weight: 167.59
MDL number: MFCD00191927
EINECS: 412-200-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB91.20 | In Stock |
|
| 5G | RMB154.40 | In Stock |
|
| 25G | RMB571.20 | In Stock |
|
| 100G | RMB4639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-197 °C (lit.) |
| Boiling point: | 348.3±42.0 °C(Predicted) |
| Density | 1.362±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Slightly Soluble (2.0 g/L) (25°C). |
| pka | 13.14±0.20(Predicted) |
| form | Solid |
| color | Light Orange to Brown |
| InChI | InChI=1S/C8H6ClNO/c9-6-1-2-7-5(3-6)4-8(11)10-7/h1-3H,4H2,(H,10,11) |
| InChIKey | WWJLCYHYLZZXBE-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2)CC1=O |
| CAS DataBase Reference | 17630-75-0(CAS DataBase Reference) |
Description and Uses
5-Chloro-2-oxindole was used for the quantitation of 5-chloro-2-oxindole, concomitantly with all of its potential positional isomers using a single, highly specific, normal-phase chromatographic system. 5-Chloro-2-oxindole (5-Chlorooxindole) is a starting material for tenidap sodium, a pharmaceutical drug candidate.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H317-H361f-H412 |
| Precautionary statements | P201-P273-P280-P301+P312+P330-P302+P352-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-43-52/53-62-36/37/38 |
| Safety Statements | 22-36/37-61-45-36/37/39-24-37/39-26 |
| WGK Germany | 2 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Repr. 2 Skin Sens. 1 |






