A2399012
5-Chloroindole , 98% , 17422-32-1
CAS NO.：17422-32-1
Empirical Formula: C8H6ClN
Molecular Weight: 151.59
MDL number: MFCD00005672
EINECS: 241-448-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB317.60 | In Stock |
|
| 100G | RMB1260.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-71 °C (lit.) |
| Boiling point: | 130 °C / 0.4mmHg |
| Density | 1.1976 (rough estimate) |
| refractive index | 1.5437 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in alcohol. |
| pka | 16.09±0.30(Predicted) |
| form | Crystalline Powder |
| color | White to slightly grayish-green |
| BRN | 2651 |
| InChI | InChI=1S/C8H6ClN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H |
| InChIKey | MYTGFBZJLDLWQG-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2)C=C1 |
| CAS DataBase Reference | 17422-32-1(CAS DataBase Reference) |
Description and Uses
5-Chloroindole has been used in the synthesis of 5-chloro-3-indole-N,N- dimethylglyoxalamide and 5-chloro-N,N-dimethyltryptamine. It may be used in the synthesis of dyestuffs in the presence of biocatalysts. 5-Chloroindole can be synthesized by using 3-chlorobenzaldehyde as starting reagent
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36-26-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29339990 |
