A2401212
2-Chloro-3-nitrobenzoic acid , 99% , 3970-35-2
CAS NO.：3970-35-2
Empirical Formula: C7H4ClNO4
Molecular Weight: 201.56
MDL number: MFCD00007069
EINECS: 223-590-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB50.40 | In Stock |
|
| 5G | RMB176.80 | In Stock |
|
| 25G | RMB636.80 | In Stock |
|
| 100g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-187 °C (lit.) |
| Boiling point: | 359.9±27.0 °C(Predicted) |
| Density | 1.6620 |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | pK1: 2.02 (25°C) |
| color | White to cream-yellow with a green cast |
| BRN | 645427 |
| InChI | InChI=1S/C7H4ClNO4/c8-6-4(7(10)11)2-1-3-5(6)9(12)13/h1-3H,(H,10,11) |
| InChIKey | JRQDVRIQJJPHEQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC([N+]([O-])=O)=C1Cl |
| CAS DataBase Reference | 3970-35-2(CAS DataBase Reference) |
Description and Uses
2-Chloro-3-nitrobenzoic acid was used as reagent during the synthesis of new biprivileged molecular scaffolds of tetracyclic indolo-benzodiazepines and indolo-quinoxalines. It was used in a microwave-promoted Ulmann condensation with 2-aminopyridines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P261-P264-P272-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37/38-36 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29163990 |
