BD9370431
2,5-Dichloro-3-nitrobenzoic acid , 95% , 88-86-8
CAS NO.:88-86-8
Empirical Formula: C7H3Cl2NO4
Molecular Weight: 236.01
MDL number: MFCD00014691
EINECS: 201-862-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB101.60 | In Stock |
|
| 1g | RMB244.80 | In Stock |
|
| 5g | RMB913.60 | In Stock |
|
| 25g | RMB3200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216-220 °C (lit.) |
| Boiling point: | 366.5±42.0 °C(Predicted) |
| Density | 1.713±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 1.56±0.20(Predicted) |
| Appearance | White to light yellow Solid |
| BRN | 1976119 |
| InChI | 1S/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
| InChIKey | AUAXYMOBWXOEQD-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(Cl)cc(c1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 88-86-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2,5-Dichloro-3-nitrobenzoic acid (88-86-8) |
Description and Uses
2,5-Dichloro-3-nitrobenzoic Acid is used in process for the preparation of organic halides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | DG7875000 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






