A2403012
2-Chloro-4-fluoropyridine , 98% , 34941-91-8
CAS NO.:34941-91-8
Empirical Formula: C5H3ClFN
Molecular Weight: 131.54
MDL number: MFCD04039345
EINECS: 675-788-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB104.80 | In Stock |
|
| 25G | RMB416.00 | In Stock |
|
| 100G | RMB1463.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 140°C |
| Density | 1,456g/cm |
| Flash point: | 140°C |
| refractive index | 1.5015 |
| storage temp. | Inert atmosphere,2-8°C |
| pka | 1.20±0.10(Predicted) |
| form | Liquid |
| color | Colorless to pale yellow |
| BRN | 1634747 |
| InChI | InChI=1S/C5H3ClFN/c6-5-3-4(7)1-2-8-5/h1-3H |
| InChIKey | FGSAQRJRWCZLOB-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(F)=C1 |
| CAS DataBase Reference | 34941-91-8(CAS DataBase Reference) |
Description and Uses
2-Chloro-4-fluoropyridine is a useful research chemical.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS07,GHS06 |
| Signal word | Danger |
| Hazard statements | H226-H302+H312+H332-H315-H318-H301-H310-H330-H335 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P310-P403+P235-P501-P301+P310a-P303+P361+P353-P304+P340-P305+P351+P338-P320-P330-P405-P501a |
| target organs | Respiratory system |
| Hazard Codes | Xi,F,Xn |
| Risk Statements | 20/21/22-36/37/38-10 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 1993 |
| WGK Germany | WGK 3 |
| Hazard Note | Flammable/Irritant |
| HazardClass | TOXIC, FLAMMABLE |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








