A2403112
3-Chloro-2-fluoropyridine , 98% , 1480-64-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB96.00 | In Stock |
|
| 25G | RMB315.20 | In Stock |
|
| 100G | RMB1016.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 162℃ |
| Density | 1.33 |
| Flash point: | 52°(126°F) |
| refractive index | 1.5030 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| pka | -2.71±0.10(Predicted) |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C5H3ClFN/c6-4-2-1-3-8-5(4)7/h1-3H |
| InChIKey | IHGMHTQDGNVKTA-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=CC=C1Cl |
| CAS DataBase Reference | 1480-64-4(CAS DataBase Reference) |
Description and Uses
3-Chloro-2-fluoropyridine is used as a reactant in the synthesis of several compounds with therapeutic potential.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS05 |
| Signal word | Warning |
| Hazard statements | H226-H302+H312+H332-H315-H319-H302-H312-H314-H318-H332 |
| Precautionary statements | P303+P361+P353-P305+P351+P338-P310-P210-P233-P240-P241+P242+P243-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P403+P235-P501 |
| Hazard Codes | T,Xn |
| Risk Statements | 22-37/38-41-34-20/21/22-10 |
| Safety Statements | 26-39-45-36/37/39 |
| RIDADR | 2924 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29333990 |
