A2403212
4-Chloro-3-fluoropyridine , 95% , 2546-56-7
CAS NO.：2546-56-7
Empirical Formula: C5H3ClFN
Molecular Weight: 131.54
MDL number: MFCD03453233
EINECS: 629-495-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB34.40 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 25G | RMB646.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -24°C(lit.) |
| Boiling point: | 139°C(lit.) |
| Density | 1.333 g/mL at 25 °C (lit.) |
| refractive index | 1.5010 to 1.5050 |
| Flash point: | 82.4 °F |
| storage temp. | 2-8°C |
| pka | 1.93±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| BRN | 1422747 |
| InChI | InChI=1S/C5H3ClFN/c6-4-1-2-8-3-5(4)7/h1-3H |
| InChIKey | BEQUUSCRAKEKQM-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(Cl)=C1F |
| CAS DataBase Reference | 2546-56-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F,Xn |
| Risk Statements | 10-36/37/38-20/21/22 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2933399990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
