A2403312
2-Cyano-5-fluoropyridine , 98% , 327056-62-2
CAS NO.:327056-62-2
Empirical Formula: C6H3FN2
Molecular Weight: 122.1
MDL number: MFCD08741371
EINECS: 627-618-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB132.80 | In Stock |
|
| 100G | RMB1800.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35-41 °C |
| Boiling point: | 214.9±20.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| Flash point: | 99 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -2.74±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C6H3FN2/c7-5-1-2-6(3-8)9-4-5/h1-2,4H |
| InChIKey | BHXHRMVSUUPOLX-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(F)C=C1 |
Description and Uses
5-Fluoro-2-pyridinecarbonitrile is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H318-H400 |
| Precautionary statements | P273-P280-P301+P312+P330-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-41-50/53 |
| Safety Statements | 26-39-60-61 |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |









