A4370012
3-Fluoropyridine-2-carboxylic acid , 98% , 152126-31-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB123.20 | In Stock |
|
| 25G | RMB551.20 | In Stock |
|
| 100G | RMB2039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154°C |
| Boiling point: | 265.2±20.0 °C(Predicted) |
| Density | 1.419±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder |
| pka | 2.71±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C6H4FNO2/c7-4-2-1-3-8-5(4)6(9)10/h1-3H,(H,9,10) |
| InChIKey | IRERRSXDWUCFIY-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=CC=C1F |
| CAS DataBase Reference | 152126-31-3(CAS DataBase Reference) |
Description and Uses
3-Fluoropyridine-2-carboxylic acid is mainly used as an intermediate in organic synthesis and medicinal chemistry. It is a synthetic intermediate of tridentate nitrogen ligands in pesticide molecules and transition metal catalytic reactions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
