BD0671032
6-Chloro-3-fluoropicolinic acid , 98% , 884494-76-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB32.00 | In Stock |
|
| 250mg | RMB75.20 | In Stock |
|
| 1g | RMB228.80 | In Stock |
|
| 5g | RMB930.40 | In Stock |
|
| 10g | RMB1760.80 | In Stock |
|
| 25g | RMB3681.60 | In Stock |
|
| 100g | RMB14433.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 296℃ |
| Density | 1.576 |
| Flash point: | 133℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 2.34±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C6H3ClFNO2/c7-4-2-1-3(8)5(9-4)6(10)11/h1-2H,(H,10,11) |
| InChIKey | YGDRQLYJJGEHCC-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC(Cl)=CC=C1F |
Description and Uses
6-Chloro-3-fluoro-pyridine-2-carboxylic acid is used as an intermediate in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2933399990 |
