A2404912
Clenbuterol solution , 1.0mg/mlinmethanol , 21898-19-1
Synonym(s):
4-Amino-α-(t-butylaminomethyl)-3,5-dichlorobenzyl alcohol hydrochloride
CAS NO.:21898-19-1
Empirical Formula: C12H19Cl3N2O
Molecular Weight: 313.65
MDL number: MFCD00083280
EINECS: 244-643-7
| Pack Size | Price | Stock | Quantity |
| 2ML | RMB125.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-175.5°C |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | Soluble in water and in ethanol (96 per cent), slightly soluble in acetone. |
| form | Solid |
| color | White to off-white |
| Merck | 14,2347 |
| InChI | 1S/C12H18Cl2N2O.ClH/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7;/h4-5,10,16-17H,6,15H2,1-3H3;1H |
| InChIKey | OPXKTCUYRHXSBK-UHFFFAOYSA-N |
| SMILES | Cl.CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 |
| CAS DataBase Reference | 21898-19-1(CAS DataBase Reference) |
Description and Uses
Antiasthmatic
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H351-H360FD |
| Precautionary statements | P201-P308+P313 |
| Hazard Codes | T,F |
| Risk Statements | 25-39/23/24/25-23/24/25-11 |
| Safety Statements | 22-36/37/39-45-36/37-16 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DN3180000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29221990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 2 Repr. 1B |
| Toxicity | LD50 in mice, rats, guinea pigs (mg/kg): 176, 315, 67.1 orally; 27.6, 35.3, 12.6 i.v. (Ueberberg) |






