A2405212
1,4-Cyclohexanedione mono(2,2-dimethyltrimethylene ketal) , 98% , 69225-59-8
Synonym(s):
3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-9-one
CAS NO.:69225-59-8
Empirical Formula: C11H18O3
Molecular Weight: 198.26
MDL number: MFCD00006652
EINECS: 273-918-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB121.60 | In Stock |
|
| 25G | RMB297.60 | In Stock |
|
| 100G | RMB1020.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-50 °C(lit.) |
| Boiling point: | 70 °C(Press: 0.05 Torr) |
| Density | 1.08±0.1 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetone, Dichloromethane, Ethyl Acetate, Methanol, |
| form | Solid |
| color | White |
| BRN | 3541930 |
| InChI | InChI=1S/C11H18O3/c1-10(2)7-13-11(14-8-10)5-3-9(12)4-6-11/h3-8H2,1-2H3 |
| InChIKey | COKVDTKAWIFNTH-UHFFFAOYSA-N |
| SMILES | O1C2(CCC(=O)CC2)OCC(C)(C)C1 |
| CAS DataBase Reference | 69225-59-8(CAS DataBase Reference) |
Description and Uses
1,4-Cyclohexanedione mono(2,2-dimethyltrimethylene ketal)is a reagent used in the preparation of carbazole derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H412 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Risk Statements | 36/37/38-52/53 |
| Safety Statements | 24/25-61 |
| WGK Germany | 3 |
| HS Code | 29329990 |



![3,3-Dimethyl-1,5-dioxaspiro[5.5]undecane](https://img.chemicalbook.com/CAS/GIF/707-29-9.gif)



