PRODUCT Properties
| Boiling point: | 83 °C/50 mmHg (lit.) |
| Density | 0.948 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.439(lit.) |
| Flash point: | 50°C |
| storage temp. | Storage temp. 2-8°C |
| solubility | Chloroform (Soluble), Ethyl Acetate (Slightly) |
| form | clear liquid |
| color | Colorless to Yellow |
| InChI | InChI=1S/C8H16O2/c1-9-8(10-2)6-4-3-5-7-8/h3-7H2,1-2H3 |
| InChIKey | XPIJMQVLTXAGME-UHFFFAOYSA-N |
| SMILES | C1(OC)(OC)CCCCC1 |
| CAS DataBase Reference | 933-40-4(CAS DataBase Reference) |
Description and Uses
1,1-Dimethoxycyclohexane is a useful research chemical used in the preparation of N-substituted valiolamine derivatives as potential oral antidiabetic agents.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241-P242-P243 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10-18 |
| Safety Statements | 16-51 |
| RIDADR | 3271 |
| WGK Germany | 3 |
| HS Code | 2911.00.5000 |
| HazardClass | 3 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |




![3,3-Dimethyl-1,5-dioxaspiro[5.5]undecane](https://img.chemicalbook.com/CAS/GIF/707-29-9.gif)

![1,4-Dioxaspiro[4.5]decane](https://img.chemicalbook.com/CAS/GIF/177-10-6.gif)
