A2406012
2-Chloro-4-methylpyridine , 98% , 3678-62-4
Synonym(s):
2-Chloro-4-picoline
CAS NO.:3678-62-4
Empirical Formula: C6H6ClN
Molecular Weight: 127.57
MDL number: MFCD00023418
EINECS: 222-951-2
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB74.40 | In Stock |
|
| 25ML | RMB195.20 | In Stock |
|
| 100ML | RMB464.80 | In Stock |
|
| 500ML | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115°C |
| Boiling point: | 194-195 °C (lit.) |
| Density | 1.142 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 193 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 0.94±0.10(Predicted) |
| Specific Gravity | 1.14 |
| color | Clear colorless to light yellow |
| InChI | InChI=1S/C6H6ClN/c1-5-2-3-8-6(7)4-5/h2-4H,1H3 |
| InChIKey | MZVSTDHRRYQFGI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(C)=C1 |
| CAS DataBase Reference | 3678-62-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Cl-4-(CH3)-pyridine(3678-62-4) |
Description and Uses
2-Chloro-4-methylpyridine is used as a reagent in the synthesis of the mGLUR5 modulators imidazolyl-ethynyl-pyridines as potential antipsychotics. It is also used in the preparation of trifluoromethyl(pyrimidinyl)azetidinecarboxamides as potent, orally bioavailable TGR5 agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



