A2406712
4-Carboxy-3-chlorobenzeneboronic acid , 97% , 136496-72-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB65.60 | In Stock |
|
| 5G | RMB227.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 236-238 |
| Boiling point: | 429.2±55.0 °C(Predicted) |
| Density | 0,88 g/cm |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to crystal |
| pka | 2.82±0.25(Predicted) |
| color | White to Almost white |
| InChI | 1S/C7H6BClO4/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,12-13H,(H,10,11) |
| InChIKey | QFAFGWXQNDYXPZ-UHFFFAOYSA-N |
| SMILES | OB(C1=CC=C(C(O)=O)C(Cl)=C1)O |
| CAS DataBase Reference | 136496-72-5(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-41 |
| Safety Statements | 26-36-39-37 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
