A2408312
2-Chloro-5-nitrobenzonitrile , 99% , 16588-02-6
CAS NO.：16588-02-6
Empirical Formula: C7H3ClN2O2
Molecular Weight: 182.56
MDL number: MFCD00007292
EINECS: 240-643-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB118.40 | In Stock |
|
| 100G | RMB326.40 | In Stock |
|
| 500g | RMB1106.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-107 °C (lit.) |
| Boiling point: | 122 °C / 0.6mmHg |
| Density | 1.6133 (rough estimate) |
| refractive index | 1.5557 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 1818642 |
| InChI | InChI=1S/C7H3ClN2O2/c8-7-2-1-6(10(11)12)3-5(7)4-9/h1-3H |
| InChIKey | ZGILLTVEEBNDOB-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC([N+]([O-])=O)=CC=C1Cl |
| CAS DataBase Reference | 16588-02-6(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-nitrobenzonitrile was used in online detection of rat glutathione S-transferase P1-specific inhibitors by high-resolution screening technology.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P264-P280-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | DI3040000 |
| HazardClass | IRRITANT |
| HS Code | 29269090 |
