A2278112
4-Chloro-2-nitroaniline , 99% , 89-63-4
Synonym(s):
1-Amino-4-chloro-2-nitrobenzene
CAS NO.:89-63-4
Empirical Formula: C6H5ClN2O2
Molecular Weight: 172.57
MDL number: MFCD00007836
EINECS: 201-925-4
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C(lit.) |
| Boiling point: | 200°C (rough estimate) |
| Density | 1.37 |
| refractive index | 1.6460 (estimate) |
| Flash point: | 191 °C |
| storage temp. | room temp |
| solubility | 0.5g/l (anhydrous substance) |
| Colour Index | 37040 |
| pka | pK1: 1.10(+1) (25°C) |
| form | Crystalline Powder or Chunks |
| color | Orange |
| PH | 7 (0.5g/l, H2O, 20℃) |
| Water Solubility | INSOLUBLE |
| BRN | 512436 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C6H5ClN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| InChIKey | PBGKNXWGYQPUJK-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)cc1[N+]([O-])=O |
| CAS DataBase Reference | 89-63-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Aniline, 4-chloro-2-nitro-(89-63-4) |
| EPA Substance Registry System | 4-Chloro-2-nitroaniline (89-63-4) |
Description and Uses
A nitro-aromatic amine with mutagenicity and carcinogenicity
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H373-H410 |
| Precautionary statements | P262-P273-P280-P302+P352+P310-P304+P340+P310-P314 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,N,T |
| Risk Statements | 26/27/28-33-51/53 |
| Safety Statements | 28-36/37-45-61-28A |
| RIDADR | UN 2237 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | BX1575000 |
| Autoignition Temperature | 964 °F |
| Hazard Note | Very Toxic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214210 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 2 STOT RE 2 |
| Hazardous Substances Data | 89-63-4(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






