A2430712
5-Chloro-2-nitroaniline , 98% , 1635-61-6
Synonym(s):
2-Amino-4-chloro-nitrobenzene
CAS NO.：1635-61-6
Empirical Formula: C6H5ClN2O2
Molecular Weight: 172.57
MDL number: MFCD00007776
EINECS: 216-661-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB20.00 | In Stock |
|
| 25G | RMB24.00 | In Stock |
|
| 100g | RMB79.20 | In Stock |
|
| 250G | RMB151.20 | In Stock |
|
| 500G | RMB263.20 | In Stock |
|
| 2.5kg | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-129 °C (dec.)(lit.) |
| Boiling point: | 200°C (rough estimate) |
| Density | 1.5610 (rough estimate) |
| refractive index | 1.5870 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Chloroform, Methanol |
| pka | -1.46±0.25(Predicted) |
| form | Liquid |
| color | Clear colorless to light yellow |
| BRN | 2210201 |
| InChI | InChI=1S/C6H5ClN2O2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H,8H2 |
| InChIKey | ZCWXYZBQDNFULS-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Cl)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 1635-61-6(CAS DataBase Reference) |
Description and Uses
5-Chloro-2-nitroaniline was used in the synthesis of 5-(4-substituted piperazin-1-yl)-2-nitroanilines and 5-(4-substituted piperazin-1-yl)benzimidazole-2-carbamates.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H373-H411 |
| Precautionary statements | P262-P273-P280-P301+P310+P330-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+,N,T |
| Risk Statements | 26/27/28-33-51/53 |
| Safety Statements | 28-36/37-45-61-28A |
| RIDADR | UN 2237 6.1/PG 3 |
| WGK Germany | 3 |
| F | 9-23 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214210 |
