A2409312
4-Chloro-3-fluorobenzoic acid , 98% , 403-17-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB84.00 | In Stock |
|
| 25G | RMB237.60 | In Stock |
|
| 100G | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-192°C |
| Boiling point: | 290.9±20.0 °C(Predicted) |
| Density | 1.477±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 3.63±0.10(Predicted) |
| color | Off-White to Pale yellow |
| InChI | InChI=1S/C7H4ClFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) |
| InChIKey | QPIBHIXKUQKNFP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Cl)C(F)=C1 |
| CAS DataBase Reference | 403-17-8(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-chloro-3-fluoro- (403-17-8) |
Description and Uses
4-Chloro-3-fluorobenzoic Acid is a very useful precursor. It is a reagent used to synthesize 6-Hydroxy Albaconazole (H761395) which is a metabolite of Albaconazole (A511450), an antifungal agent as neuroprotectant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37-26 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |






