A2409612
2-Chloro-4-methylpyrimidine , 99% , 13036-57-2
Synonym(s):
2-Chloro-4-methylpyrimidine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB55.20 | In Stock |
|
| 10G | RMB108.80 | In Stock |
|
| 25G | RMB222.40 | In Stock |
|
| 100g | RMB660.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35-36°C |
| Boiling point: | 94°C/17mmHg(lit.) |
| Density | 1.234±0.06 g/cm3(Predicted) |
| Flash point: | 98℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform |
| pka | -0.93±0.20(Predicted) |
| form | Solid |
| color | Pale Yellow to Beige |
| Sensitive | Moisture Sensitive |
| Stability: | Toxic |
| InChI | InChI=1S/C5H5ClN2/c1-4-2-3-7-5(6)8-4/h2-3H,1H3 |
| InChIKey | BHAKRVSCGILCEW-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(C)=N1 |
| CAS DataBase Reference | 13036-57-2(CAS DataBase Reference) |
Description and Uses
2-Chloro-4-methylpyrimidine (cas# 13036-57-2) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-41-37/38 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| TSCA | N |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
