BD5135753
2-Chloro-4-methylthiazole , 98+% , 26847-01-8
CAS NO.:26847-01-8
Empirical Formula: C4H4ClNS
Molecular Weight: 133.6
MDL number: MFCD00051033
EINECS: 248-046-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB102.40 | In Stock |
|
| 5g | RMB496.80 | In Stock |
|
| 25g | RMB1908.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 203℃ |
| Density | 1.331 |
| Flash point: | 76℃ |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | 1.36±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C4H4ClNS/c1-3-2-7-4(5)6-3/h2H,1H3 |
| InChIKey | SYDUUJIIXIOTQT-UHFFFAOYSA-N |
| SMILES | S1C=C(C)N=C1Cl |
Description and Uses
2-Chloro-4-methylthiazole is a useful research chemical, a nitrification inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H312-H315-H332-H302-H227-H319-H335 |
| Precautionary statements | P261-P271-P304+P340-P312-P264-P270-P301+P312-P330-P501-P210-P280-P370+P378-P403+P235-P501-P280-P302+P352-P312-P322-P363-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| HS Code | 2934100090 |





