A2409712
4-Chloro-3-fluoroaniline , 98% , 367-22-6
Synonym(s):
4-Chloro-3-fluorophenylamine
CAS NO.：367-22-6
Empirical Formula: C6H5ClFN
Molecular Weight: 145.56
MDL number: MFCD01090987
EINECS: 206-683-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB113.60 | In Stock |
|
| 25G | RMB348.00 | In Stock |
|
| 100G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61 |
| Boiling point: | 226°C(lit.) |
| Density | 1.349±0.06 g/cm3(Predicted) |
| Flash point: | 60 - 62°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.94±0.10(Predicted) |
| color | White to Gray to Red |
| BRN | 2716278 |
| InChI | InChI=1S/C6H5ClFN/c7-5-2-1-4(9)3-6(5)8/h1-3H,9H2 |
| InChIKey | ACMJJQYSPUPMPN-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Cl)C(F)=C1 |
| CAS DataBase Reference | 367-22-6(CAS DataBase Reference) |
Description and Uses
4-Chloro-3-fluoroaniline is used in the synthesis of Methyl 5-Chloro-4-fluoro-1H-indole-2-carboxylate
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H311+H331-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-63-45-38 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
