A2592112
3-Chloro-2-fluoroaniline , >98.0%(GC) , 2106-04-9
CAS NO.：2106-04-9
Empirical Formula: C6H5ClFN
Molecular Weight: 145.56
MDL number: MFCD00069415
EINECS: 218-283-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB40.00 | In Stock |
|
| 100G | RMB88.80 | In Stock |
|
| 500G | RMB292.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 214 °C (lit.) |
| Density | 1.324 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | 2.15±0.10(Predicted) |
| Specific Gravity | 1.34 |
| color | Colorless to Brown |
| InChI | InChI=1S/C6H5ClFN/c7-4-2-1-3-5(9)6(4)8/h1-3H,9H2 |
| InChIKey | XWBTZHDDWRNOQH-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(Cl)=C1F |
| CAS DataBase Reference | 2106-04-9(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Chloro-2-fluoroaniline (2106-04-9) |
Description and Uses
3-Chloro-2-fluoroaniline may be used in the preparation of 2-chloro-3-fluorobromobenzene and 4-((3-chloro-2-fluorophenyl)amino)-7-methoxyquinazolin-6-yl acetate.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 36/37/38-20/21/22-41-37/38-22-23/24/25 |
| Safety Statements | 26-36-36/37/39-39-45 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| TSCA | Yes |
| HazardClass | 6.1 |
| HazardClass | IRRITANT |
| HS Code | 29214200 |
